Compound Interest for SSC CGL — Formulas, Shortcuts & Solved PYQs

intermediate 18 min read

Concept

Simple interest (साधारण ब्याज) pays you interest only on the original principal. Compound interest (चक्रवृद्धि ब्याज) pays you interest on the principal plus all the interest you have already earned. That single difference is why compounding is called "interest on interest" — and it is the reason every examiner loves it.

Here is a concrete analogy. Imagine you deposit ₹1,000 at 10% per annum. Under simple interest, every year you earn exactly ₹100 — always calculated on the original ₹1,000. Under compound interest, the first year you still earn ₹100, but now your balance is ₹1,100. In the second year, 10% is applied to ₹1,100, so you earn ₹110. That extra ₹10 is the "compounding effect." It looks small at 10% for 2 years, but over long periods or at high rates, the gap between CI and SI becomes significant.

In SSC CGL, compound interest questions appear almost every year in the Quantitative Aptitude section. The question types you will see are:

The core formula is:

A=P(1+r100)nA = P\left(1 + \frac{r}{100}\right)^n

where AA is the final amount, PP is the principal, rr is the annual rate of interest, and nn is the number of years. The compound interest itself is CI=APCI = A - P.

You do not need calculus, you do not need logarithms (for standard CGL questions). What you need is fast arithmetic with a few power expansions memorised and two or three structural shortcuts locked in. That is exactly what this page gives you.


Deep Dive

The Core Formula and Its Variants

The standard formula is:

A=P(1+r100)nA = P\left(1 + \frac{r}{100}\right)^n

For half-yearly compounding, the rate is halved and the number of periods is doubled:

A=P(1+r200)2nA = P\left(1 + \frac{r}{200}\right)^{2n}

For quarterly compounding:

A=P(1+r400)4nA = P\left(1 + \frac{r}{400}\right)^{4n}

Look — the pattern is mechanical. Whatever the compounding frequency, divide the rate by the number of periods per year and multiply nn by the same number. SSC CGL almost always sticks to annual or half-yearly compounding, so memorise those two.

CI vs SI: The Difference Formulas

This is the single most tested sub-type. The difference between CI and SI for 2 years has a clean closed form:

CISI=P(r100)2CI - SI = P \cdot \left(\frac{r}{100}\right)^2

For 3 years, the difference is:

CISI=P(r100)2(3+r100)CI - SI = P \cdot \left(\frac{r}{100}\right)^2 \cdot \left(3 + \frac{r}{100}\right)

These are not approximations — they are exact. Derive them once, then just use them. Here is the 2-year derivation so you understand why it works:

SI2=P2r100SI_2 = P \cdot \frac{2r}{100}

CI2=P[(1+r100)21]=P[1+2r100+r2100001]=P2r100+Pr210000CI_2 = P\left[\left(1 + \frac{r}{100}\right)^2 - 1\right] = P\left[1 + \frac{2r}{100} + \frac{r^2}{10000} - 1\right] = P \cdot \frac{2r}{100} + P \cdot \frac{r^2}{10000}

CI2SI2=Pr210000=P(r100)2CI_2 - SI_2 = P \cdot \frac{r^2}{10000} = P \cdot \left(\frac{r}{100}\right)^2

The only term left after cancellation is the square of the rate on the principal — which is why it is so clean.

Successive Year Breakdown

For 2-year problems, breaking the interest year-by-year is often faster than expanding the full formula:

At 10% on ₹8,000: Year 1 interest = ₹800, new base = ₹8,800, Year 2 interest = ₹880. Total CI = ₹1,680. That took about 10 seconds — faster than computing (1.1)2(1.1)^2 and multiplying.

Doubling and Tripling Time

If a principal doubles in tt years at CI, it will be 2k2^k times the principal in k×tk \times t years. This is a pure exponent logic:

The trap variant: "double in 5 years at SI — how long to quadruple?" SI is linear, not exponential. Doubling under SI takes 5 years, so quadrupling takes exactly 15 years (not 10). Do not apply exponential logic to SI doubling questions.

Common Power Expansions Worth Memorising

| Factor | Value | |---|---| | (1.05)2(1.05)^2 | 1.10251.1025 | | (1.05)3(1.05)^3 | 1.1576251.157625 | | (1.08)2(1.08)^2 | 1.16641.1664 | | (1.10)2(1.10)^2 | 1.211.21 | | (1.04)2(1.04)^2 | 1.08161.0816 | | (1.06)3(1.06)^3 | 1.1910161.191016 |

These six cover roughly 80% of SSC CGL compound interest questions. You do not need to derive them in the exam hall — just have them at your fingertips.

Effective Rate of Interest

When compounding is more frequent than annual, the effective annual rate is higher than the nominal rate. For half-yearly compounding at nominal rate rr:

reff=(1+r200)21r_{eff} = \left(1 + \frac{r}{200}\right)^2 - 1

SSC CGL rarely asks this directly, but understanding it helps you cross-check answers in half-yearly compounding problems.


Memory Tricks & Shortcuts

patternYear-by-Year Build for 2-Year CI

When n = 2, skip the formula entirely. Compute Year 1 interest on P, add it to get a new base, compute Year 2 interest on the new base, add both. At 10% on ₹8,000: Year 1 = ₹800, base becomes ₹8,800, Year 2 = ₹880, CI = ₹1,680. Standard formula route: expand (1.1)² = 1.21, multiply 8000 × 0.21 — same answer but 2 extra arithmetic steps. Year-by-year: ~8 seconds. Formula expansion: ~20 seconds.

pattern2-Year CI-SI Difference in One Shot

Use CISI=P×(r/100)2CI - SI = P \times (r/100)^2 directly. For ₹10,000 at 5%: 10000×(0.05)2=10000×0.0025=2510000 \times (0.05)^2 = 10000 \times 0.0025 = ₹25. No need to compute CI and SI separately and subtract. Standard route (compute both, subtract): 4 steps. This formula: 1 step. Speed gain: saves 3 calculation steps, eliminates one subtraction error.

patternDoubling Chain for Power-of-2 Multiples

If P doubles in t years at CI, it becomes 2kP2^k \cdot P in k×tk \times t years. Memorise the chain: 2×2\times in tt, 4×4\times in 2t2t, 8×8\times in 3t3t, 16×16\times in 4t4t. When the question asks "4 times" after telling you "doubles in 5 years", write "10 years" immediately. Standard algebraic route requires setting up (1+r){10}(1+r)^\{10\} equations. Chain method: 3 seconds.

substitutionHalf-Yearly Rate Swap

For half-yearly compounding, substitute rr/2r \to r/2 and n2nn \to 2n before applying the standard formula. Example: 10% half-yearly for 2 years becomes 5% for 4 periods. Now use (1.05)4(1.05)^4 — a standard expansion — instead of trying to process the original fractions. This substitution reduces half-yearly problems to identical structure as annual problems, cutting mental load. Works for quarterly too: rr/4r \to r/4, n4nn \to 4n.

estimationPercentage Markup Chain for 3-Year CI

Express the rate as a percentage gain each year and chain-multiply. For 6% over 3 years on ₹5,000: after Year 1, amount = 5000×1.06=53005000 \times 1.06 = 5300; Year 2 = 5300×1.06=56185300 \times 1.06 = 5618; Year 3 = 5618×1.06=5955.085618 \times 1.06 = 5955.08. CI = ₹955.08. This avoids computing (1.06)3=1.191016(1.06)^3 = 1.191016 from scratch if you have not memorised it — each multiplication is a simple 6% markup, not a cube. Step count: 3 multiplications vs. one cube-root-free but less intuitive formula expansion.


Fast-Solving Framework

Read the question and immediately identify which of these four situations applies:

Situation 1 — Standard CI (given P, r, n, find CI or A):

Situation 2 — CI minus SI:

Situation 3 — Doubling / tripling / 4x problems:

Situation 4 — Half-yearly or quarterly compounding:

If the answer options are far apart, use estimation — compute to 2 decimal places and match. If options are close (like ₹5,408 vs ₹5,400 vs ₹5,416), you must compute exactly.


Solved PYQs

Why this question: Tests basic 2-year CI computation — the most common question type. Distinguishing CI from SI is the core trap here.

Previous Year Questionपिछले वर्ष का प्रश्न
What is the compound interest on ₹8,000 at 10% per annum for 2 years, compounded annually?
₹8,000 पर 10% प्रति वर्ष की दर से 2 वर्षों का चक्रवृद्धि ब्याज (वार्षिक रूप से संयोजित) कितना होगा?
  1. ₹1,800
  2. ₹1,600
  3. ₹1,720
  4. ₹1,680
  1. ₹1,800
  2. ₹1,600
  3. ₹1,720
  4. ₹1,680
Solutionसमाधान
CI = P[(1 + r/100)^n - 1] = 8000[(1.1)^2 - 1] = 8000[1.21 - 1] = 8000 × 0.21 = ₹1,680. Simple interest would have been ₹1,600, making ₹1,680 the correct compound interest.
CI = P[(1 + r/100)^n - 1] = 8000[(1.1)^2 - 1] = 8000 × 0.21 = ₹1,680। साधारण ब्याज ₹1,600 होता, लेकिन चक्रवृद्धि ब्याज ₹1,680 है।

Solving path: Use year-by-year build. Year 1 interest on ₹8,000 at 10% = ₹800. New principal = ₹8,800. Year 2 interest = ₹880. Total CI = ₹800 + ₹880 = ₹1,680. Option D. Note that option B (₹1,600) is the SI trap — if you used P×r×n/100=8000×10×2/100P \times r \times n / 100 = 8000 \times 10 \times 2 / 100, you get ₹1,600. That is the most common error on this type.


Why this question: Tests finding the final amount (not just CI). Students sometimes confuse amount with interest.

Previous Year Questionपिछले वर्ष का प्रश्न
A sum of ₹5,000 is invested at 4% per annum compound interest for 2 years. What is the amount at the end of 2 years?
₹5,000 की राशि 4% प्रति वर्ष चक्रवृद्धि ब्याज दर पर 2 वर्षों के लिए निवेश की जाती है। 2 वर्षों के अंत में कुल राशि क्या होगी?
  1. ₹5,200
  2. ₹5,416
  3. ₹5,400
  4. ₹5,408
  1. ₹5,200
  2. ₹5,416
  3. ₹5,400
  4. ₹5,408
Solutionसमाधान
Amount = P(1 + r/100)^n = 5000 × (1.04)^2 = 5000 × 1.0816 = ₹5,408. The simple interest amount would be ₹5,400, but compound interest gives ₹5,408.
राशि = P(1 + r/100)^n = 5000 × (1.04)^2 = 5000 × 1.0816 = ₹5,408। साधारण ब्याज पर राशि ₹5,400 होती, जबकि चक्रवृद्धि ब्याज पर ₹5,408 होती है।

Solving path: (1.04)2=1.0816(1.04)^2 = 1.0816. Amount =5000×1.0816=5,408= 5000 \times 1.0816 = ₹5,408. Option D. Option C (₹5,400) is the SI amount trap: 5000+5000×0.04×2=5000+400=54005000 + 5000 \times 0.04 \times 2 = 5000 + 400 = 5400. The compounding adds ₹8 extra — small but that is exactly what the options test.


Why this question: The CI-SI difference type. This is the purest test of whether you know the shortcut formula.

Previous Year Questionपिछले वर्ष का प्रश्न
The difference between compound interest and simple interest on ₹10,000 at 5% per annum for 2 years is:
₹10,000 पर 5% प्रति वर्ष की दर से 2 वर्षों में चक्रवृद्धि ब्याज और साधारण ब्याज का अंतर कितना होगा?
  1. ₹20
  2. ₹100
  3. ₹50
  4. ₹25
  1. ₹20
  2. ₹100
  3. ₹50
  4. ₹25
Solutionसमाधान
Difference = P(r/100)^2 = 10000 × (5/100)^2 = 10000 × 0.0025 = ₹25. This formula directly gives the difference between CI and SI for 2 years.
अंतर = P(r/100)^2 = 10000 × (5/100)^2 = 10000 × 0.0025 = ₹25। यह सूत्र 2 वर्षों के लिए CI और SI के बीच का अंतर सीधे देता है।

Solving path: Direct formula: CISI=P(r/100)2=10000×(5/100)2=10000×0.0025=25CI - SI = P(r/100)^2 = 10000 \times (5/100)^2 = 10000 \times 0.0025 = ₹25. Option D. If you computed CI and SI separately: SI=10000×5×2/100=1000SI = 10000 \times 5 \times 2 / 100 = ₹1000; CI=10000×[(1.05)21]=10000×0.1025=1025CI = 10000 \times [(1.05)^2 - 1] = 10000 \times 0.1025 = ₹1025; difference = ₹25. Same answer, 4 extra steps. The shortcut formula saves you in the exam hall.


Why this question: Tests 3-year compound interest with a non-round rate. Requires either the memorised (1.06)3(1.06)^3 or the chain multiplication approach.

Previous Year Questionपिछले वर्ष का प्रश्न
The compound interest on ₹5,000 for 3 years at 6% per annum is approximately:
₹5,000 पर 6% प्रति वर्ष की दर से 3 वर्षों का चक्रवृद्धि ब्याज लगभग कितना होगा?
  1. ₹900
  2. ₹980.40
  3. ₹930.50
  4. ₹955.08
  1. ₹900
  2. ₹980.40
  3. ₹930.50
  4. ₹955.08
Solutionसमाधान
A = 5000 × (1.06)³ = 5000 × 1.191016 = ₹5,955.08. CI = 5955.08 - 5000 = ₹955.08.
A = 5000 × (1.06)³ = 5000 × 1.191016 ≈ ₹5,955.08। चक्रवृद्धि ब्याज = 5955.08 - 5000 = ₹955.08।

Solving path: Use chain multiplication. Year 1: 5000×1.06=5,3005000 \times 1.06 = ₹5,300. Year 2: 5300×1.06=5,6185300 \times 1.06 = ₹5,618. Year 3: 5618×1.06=5,955.085618 \times 1.06 = ₹5,955.08. CI = 5955.085000=955.085955.08 - 5000 = ₹955.08. Option D. Alternatively, (1.06)3=1.191016(1.06)^3 = 1.191016, so 5000×1.191016=5955.085000 \times 1.191016 = 5955.08. Note option B (₹980.40) is a common distractor for aspirants who miscalculate the chain multiplication.


Why this question: The doubling-time problem type. Conceptual, no heavy computation needed.

Previous Year Questionपिछले वर्ष का प्रश्न
A principal doubles itself in 5 years at compound interest. In how many years will it become 4 times?
कोई मूलधन चक्रवृद्धि ब्याज पर 5 वर्षों में दोगुना हो जाता है। कितने वर्षों में यह 4 गुना हो जाएगा?
  1. 8 years
  2. 20 years
  3. 10 years
  4. 15 years
  1. 8 वर्ष
  2. 20 वर्ष
  3. 10 वर्ष
  4. 15 वर्ष
Solutionसमाधान
If P doubles in 5 years, then in 5 more years it doubles again, making it 4P. So total time = 10 years.
यदि मूलधन 5 वर्षों में दोगुना होता है, तो अगले 5 वर्षों में फिर दोगुना होकर 4 गुना हो जाएगा। कुल समय = 10 वर्ष।

Solving path: PP doubles in 5 years means after 5 years: 2P2P. After 5 more years (10 total), the 2P2P doubles again to 4P4P. Answer: 10 years. Option C. The logic is that at CI, equal time intervals produce equal multiplier effects — every 5 years the amount multiplies by 2. 4=224 = 2^2, so you need 2 intervals of 5 years = 10 years. Do not add 5 + 5 = 10 years mechanically without understanding the exponential structure, or you will fail the "8 times" variant.


Common Mistakes


Related Topics

Practice on SarkariRise

Sign up + get 3 free mocks →