NDA गणित — त्रिकोणमितीय अनुपात और सर्वसमिकाएँ

intermediate 22 min read

अवधारणा

त्रिकोणमिति — यह सिर्फ़ sin, cos, tan याद करने का विषय नहीं है। यह एक भाषा है जिसमें कोण और अनुपात आपस में बात करते हैं।

एक right-angle triangle की कल्पना करो। कर्ण (hypotenuse), लम्ब (perpendicular), और आधार (base)। किसी कोण θ के लिए:

sinθ=लम्बकर्ण,cosθ=आधारकर्ण,tanθ=लम्बआधार\sin\theta = \frac{\text{लम्ब}}{\text{कर्ण}}, \quad \cos\theta = \frac{\text{आधार}}{\text{कर्ण}}, \quad \tan\theta = \frac{\text{लम्ब}}{\text{आधार}}

ये तीन मूल अनुपात हैं। बाकी तीन — cosec, sec, cot — इन्हीं के व्युत्क्रम (reciprocals) हैं।

एक analogy: मान लो तुम एक पहाड़ी रास्ते पर चल रहे हो। रास्ते की ढाल का कोण θ है। तो जितनी ऊँचाई तुम चढ़े वो sin θ × कुल दूरी है, और ज़मीन पर तय की गई दूरी cos θ × कुल दूरी है। यही त्रिकोणमितीय अनुपातों का असली मतलब है।

सर्वसमिकाएँ (Identities) वो समीकरण हैं जो हर कोण के लिए सत्य होती हैं। ये triangle की geometry से directly निकलती हैं — Pythagoras theorem से:

sin2θ+cos2θ=1\sin^2\theta + \cos^2\theta = 1

यह एक ऐसा fact है जो कभी बदलता नहीं — θ का कोई भी मान हो। इससे दो और identities बनती हैं:

1+tan2θ=sec2θ1+cot2θ=cosec2θ1 + \tan^2\theta = \sec^2\theta \qquad 1 + \cot^2\theta = \text{cosec}^2\theta

NDA में इन identities को directly पूछा नहीं जाता — लेकिन हर दूसरे सवाल में इन्हें किसी-न-किसी रूप में इस्तेमाल करना पड़ता है। जो student इन्हें automatically apply करना जानता है, वो 30-40 seconds बचाता है प्रति सवाल।


गहन विश्लेषण

मूल अनुपातों की सारणी

NDA में standard angles के values बिना calculator के देने होते हैं। इन्हें pattern से याद करो:

| कोण | sin | cos | tan | |-----|-----|-----|-----| | 0° | 0 | 1 | 0 | | 30° | 1/2 | √3/2 | 1/√3 | | 45° | 1/√2 | 1/√2 | 1 | | 60° | √3/2 | 1/2 | √3 | | 90° | 1 | 0 | अपरिभाषित |

Pattern: sin के लिए क्रम है — 02,12,22,32,42\frac{\sqrt{0}}{2}, \frac{\sqrt{1}}{2}, \frac{\sqrt{2}}{2}, \frac{\sqrt{3}}{2}, \frac{\sqrt{4}}{2}। cos के लिए यही क्रम उल्टा है।

संयुक्त कोण सूत्र (Compound Angle Formulas)

ये NDA में सबसे ज़्यादा आने वाले सूत्र हैं:

sin(A±B)=sinAcosB±cosAsinB\sin(A \pm B) = \sin A \cos B \pm \cos A \sin B

cos(A±B)=cosAcosBsinAsinB\cos(A \pm B) = \cos A \cos B \mp \sin A \sin B

tan(A±B)=tanA±tanB1tanAtanB\tan(A \pm B) = \frac{\tan A \pm \tan B}{1 \mp \tan A \tan B}

Important special case: जब A=B=θA = B = \theta हो:

sin2θ=2sinθcosθ\sin 2\theta = 2\sin\theta\cos\theta

cos2θ=cos2θsin2θ=12sin2θ=2cos2θ1\cos 2\theta = \cos^2\theta - \sin^2\theta = 1 - 2\sin^2\theta = 2\cos^2\theta - 1

tan2θ=2tanθ1tan2θ\tan 2\theta = \frac{2\tan\theta}{1 - \tan^2\theta}

Triple Angle Formulas

sin3θ=3sinθ4sin3θ\sin 3\theta = 3\sin\theta - 4\sin^3\theta

cos3θ=4cos3θ3cosθ\cos 3\theta = 4\cos^3\theta - 3\cos\theta

tan3θ=3tanθtan3θ13tan2θ\tan 3\theta = \frac{3\tan\theta - \tan^3\theta}{1 - 3\tan^2\theta}

Product-to-Sum और Sum-to-Product

ये formulas NDA में directly PYQ की तरह नहीं आते, लेकिन lengthy expressions को simplify करने में काम आते हैं:

2sinAcosB=sin(A+B)+sin(AB)2\sin A \cos B = \sin(A+B) + \sin(A-B)

2cosAcosB=cos(A+B)+cos(AB)2\cos A \cos B = \cos(A+B) + \cos(A-B)

sinC+sinD=2sinC+D2cosCD2\sin C + \sin D = 2\sin\frac{C+D}{2}\cos\frac{C-D}{2}

cosC+cosD=2cosC+D2cosCD2\cos C + \cos D = 2\cos\frac{C+D}{2}\cos\frac{C-D}{2}

आवर्तकाल (Period) — एक ज़रूरी concept

sinx\sin x और cosx\cos x का आवर्तकाल 2π2\pi है। tanx\tan x और cotx\cot x का आवर्तकाल π\pi है।

जब argument में coefficient हो — sin(nx)\sin(nx) का आवर्तकाल 2πn\frac{2\pi}{n} होता है।

दो functions के योग का आवर्तकाल: दोनों के आवर्तकालों का LCM लो। लेकिन यहाँ LCM rational numbers में निकालनी होती है — ab\frac{a}{b} और cd\frac{c}{d} का LCM = LCM(a,c)GCD(b,d)\frac{\text{LCM}(a,c)}{\text{GCD}(b,d)}

Componendo-Dividendo — एक powerful tool

जब भी mn=f(θ)\frac{m}{n} = f(\theta) की शक्ल दिखे और m+nmn\frac{m+n}{m-n} पूछा जाए, तो componendo-dividendo directly apply करो:

mn=k    m+nmn=k+1k1\frac{m}{n} = k \implies \frac{m+n}{m-n} = \frac{k+1}{k-1}

यह NDA में एक बार direct PYQ बन चुका है।

Special Angles — sin 18° और sin 36°

5×18°=90°5 \times 18° = 90° का trick:

माना θ=18°\theta = 18°, तो 5θ=90°5\theta = 90°, अतः 2θ=90°3θ2\theta = 90° - 3\theta

sin2θ=cos3θ\sin 2\theta = \cos 3\theta लिखो, expand करो:

2sinθcosθ=4cos3θ3cosθ2\sin\theta\cos\theta = 4\cos^3\theta - 3\cos\theta

cosθ0\cos\theta \neq 0 से divide करने पर:

2sinθ=4(1sin2θ)32\sin\theta = 4(1 - \sin^2\theta) - 3

4sin2θ+2sinθ1=04\sin^2\theta + 2\sin\theta - 1 = 0

sinθ=2+208=514\sin\theta = \frac{-2 + \sqrt{20}}{8} = \frac{\sqrt{5} - 1}{4}

(negative root छोड़ो क्योंकि 18°18° पहले quadrant में है।)

Triangle identity: A + B + C = 180°

जब किसी triangle में A+B+C=180°A + B + C = 180° हो, तो:

tanA2tanB2+tanB2tanC2+tanC2tanA2=1\tan\frac{A}{2}\tan\frac{B}{2} + \tan\frac{B}{2}\tan\frac{C}{2} + \tan\frac{C}{2}\tan\frac{A}{2} = 1

यह इस तरह काम करता है: A+B+C2=90°\frac{A+B+C}{2} = 90°, इसलिए C2=90°A+B2\frac{C}{2} = 90° - \frac{A+B}{2}

अतः tanC2=cotA+B2=1tanA2tanB2tanA2+tanB2\tan\frac{C}{2} = \cot\frac{A+B}{2} = \frac{1-\tan\frac{A}{2}\tan\frac{B}{2}}{\tan\frac{A}{2}+\tan\frac{B}{2}}

इसे रखकर simplify करने पर ऊपर वाला result मिलता है।


शॉर्टकट और युक्तियाँ

pattern(1+tanθ)/(1-tanθ) पहचान

जब भी 1+tanθ1tanθ\frac{1 + \tan\theta}{1 - \tan\theta} दिखे, तुरंत पहचानो कि यह tan(45°+θ)\tan(45° + \theta) है।

क्यों? tan(45°+θ)=tan45°+tanθ1tan45°tanθ=1+tanθ1tanθ\tan(45° + \theta) = \frac{\tan 45° + \tan\theta}{1 - \tan 45° \cdot \tan\theta} = \frac{1 + \tan\theta}{1 - \tan\theta}

Example: (1+tan15°)/(1tan15°)=tan(60°)=3(1 + \tan 15°)/(1 - \tan 15°) = \tan(60°) = \sqrt{3}

Standard method: tan15°=23\tan 15° = 2 - \sqrt{3} निकालो, फिर substitute करो — 60 seconds। यह shortcut: direct recognition — 8 seconds।

substitutionComplementary angles का tan-cot swap

जब α+β=π2\alpha + \beta = \frac{\pi}{2} हो, तो tanβ=cotα=1tanα\tan\beta = \cot\alpha = \frac{1}{\tan\alpha}

अगर mtanβ=ntanαm\tan\beta = n\tan\alpha दिया है और m+nmn\frac{m+n}{m-n} पूछा है:

  • m1tanα=ntanαm \cdot \frac{1}{\tan\alpha} = n\tan\alpha से mn=tan2α\frac{m}{n} = \tan^2\alpha
  • αβ\alpha - \beta और α+β\alpha + \beta दोनों दिए हों तो α\alpha और β\beta निकालो
  • Componendo-dividendo: m+nmn=tan2α+1tan2α1\frac{m+n}{m-n} = \frac{\tan^2\alpha + 1}{\tan^2\alpha - 1}

Standard: algebra में 5-6 steps — 90 seconds। यह method: 3 steps — 25 seconds।

patternLCM of fractions for Period

f(x)=sin(ax)+cos(bx)f(x) = \sin(ax) + \cos(bx) का period निकालना:

Step 1: Individual periods = 2πa\frac{2\pi}{a} और 2πb\frac{2\pi}{b} Step 2: LCM(2πa,2πb)=2πLCM(1,1)GCD(a,b)=2πGCD(a,b)\text{LCM}\left(\frac{2\pi}{a}, \frac{2\pi}{b}\right) = \frac{2\pi \cdot \text{LCM}(1,1)}{\text{GCD}(a,b)} = \frac{2\pi}{\text{GCD}(a,b)}

Example: sin3x+cos4x\sin 3x + \cos 4x: GCD(3,4) = 1, तो period = 2π1=2π\frac{2\pi}{1} = 2\pi

Standard method (LCM of 2π3\frac{2\pi}{3} और π2\frac{\pi}{2} निकालना): 4 steps — 45 seconds। यह shortcut: 1 step — 10 seconds।

patternsin 18° और cos 36° से जुड़े values

इन्हें रटो मत — एक pattern से याद करो:

sin18°=514,cos36°=5+14\sin 18° = \frac{\sqrt{5}-1}{4}, \quad \cos 36° = \frac{\sqrt{5}+1}{4}

Pattern: दोनों में 5\sqrt{5} है। 18° में minus, 36° में plus। और दोनों में denominator 4 है।

Cross-check: cos36°=12sin218°=12(514)2=5+14\cos 36° = 1 - 2\sin^2 18° = 1 - 2\left(\frac{\sqrt{5}-1}{4}\right)^2 = \frac{\sqrt{5}+1}{4} — यह internally consistent है।

Memory time: 5 seconds। Without this pattern: derivation में 3-4 minutes।

patterntan(α+β) = 1 की पहचान

जब tanα=12\tan\alpha = \frac{1}{2} और tanβ=13\tan\beta = \frac{1}{3} हो:

tanα+tanβ=12+13=56\tan\alpha + \tan\beta = \frac{1}{2} + \frac{1}{3} = \frac{5}{6}

1tanαtanβ=116=561 - \tan\alpha\tan\beta = 1 - \frac{1}{6} = \frac{5}{6}

चूँकि numerator = denominator, तो tan(α+β)=1\tan(\alpha+\beta) = 1, यानी α+β=45°\alpha + \beta = 45°

Rule: जब tanαtanβ+(tanα+tanβ)=1\tan\alpha\tan\beta + (\tan\alpha + \tan\beta) = 1, तो sum directly देखो — अगर numerator = denominator तो answer = 1। Calculation skip।

Standard: पूरा division — 30 seconds। यह recognition: 8 seconds।


तेज़-समाधान रूपरेखा

परीक्षा हॉल में त्रिकोणमिति का सवाल देखते ही यह sequence follow करो:

Step 1 — Type पहचानो:

Step 2 — Values देखो:

Step 3 — Period का सवाल हो तो:

Step 4 — Componendo-Dividendo:

Step 5 — अगर कुछ नहीं दिखा:


हल किए गए PYQs

क्यों यह प्रश्न: Complementary angles और componendo-dividendo का combination — NDA में दोनों concepts एक साथ test होते हैं।

Previous Year Questionपिछले वर्ष का प्रश्न2026
If α and β are complementary angles such that α - β = π/6 and m tan β = n tan α, then what is ((m+n)/(m-n)) equal to?
  1. 2
  2. 2/√3
  3. 1
  4. 1/√3
Solutionसमाधान
Since α + β = π/2, β = π/2 - α, so tan β = cot α. From m tan β = n tan α: m cot α = n tan α, so m/n = tan²α. Using componendo-dividendo: (m+n)/(m-n) = (tan²α + 1)/(tan²α - 1). With α - β = π/6 and α + β = π/2, we get α = π/3, β = π/6. tan²(π/3) = 3, so (3+1)/(3-1) = 4/2 = 2.

समाधान का रास्ता: α+β=π2\alpha + \beta = \frac{\pi}{2} से tanβ=cotα\tan\beta = \cot\alpha। फिर mcotα=ntanαm\cot\alpha = n\tan\alphamn=tan2α\frac{m}{n} = \tan^2\alphaαβ=π6\alpha - \beta = \frac{\pi}{6} और α+β=π2\alpha + \beta = \frac{\pi}{2} solve करो: α=π3\alpha = \frac{\pi}{3}tan2π3=3\tan^2\frac{\pi}{3} = 3। Componendo-dividendo: 3+131=2\frac{3+1}{3-1} = 2


क्यों यह प्रश्न: आवर्तकाल (period) का सवाल NDA में लगभग हर paper में आता है। GCD shortcut याद हो तो 10 seconds।

Previous Year Questionपिछले वर्ष का प्रश्न
The period of the function f(x) = sin 3x + cos 4x is:
फलन f(x) = sin 3x + cos 4x का आवर्तकाल है:
  1. π
  2. π/2
  1. π
  2. π/2
Solutionसमाधान
The period of sin 3x is 2π/3, and the period of cos 4x is 2π/4 = π/2. The period of f(x) = sin 3x + cos 4x is the LCM of 2π/3 and π/2. LCM(2π/3, π/2) = 2π.
sin 3x का आवर्त 2π/3 है, और cos 4x का आवर्त 2π/4 = π/2 है। f(x) = sin 3x + cos 4x का आवर्त 2π/3 और π/2 का LCM है। LCM(2π/3, π/2) = 2π।

समाधान का रास्ता: sin3x\sin 3x का period = 2π3\frac{2\pi}{3}, cos4x\cos 4x का period = 2π4=π2\frac{2\pi}{4} = \frac{\pi}{2}। LCM(2π3,π2)\left(\frac{2\pi}{3}, \frac{\pi}{2}\right) = 2πLCM(1,1)GCD(3,2)=2π1=2π\frac{2\pi \cdot \text{LCM}(1,1)}{\text{GCD}(3,2)} = \frac{2\pi}{1} = 2\pi


क्यों यह प्रश्न: cos(AB)\cos(A-B) formula का direct application — sin और cos values Pythagoras से निकालो।

Previous Year Questionपिछले वर्ष का प्रश्न
If cos A = 3/5 and cos B = 5/13, where A and B are acute angles, then cos(A - B) equals:
यदि cos A = 3/5 और cos B = 5/13 हैं, जहाँ A और B न्यूनकोण हैं, तो cos(A - B) का मान है:
  1. 63/65
  2. 56/65
  3. 16/65
  4. 33/65
  1. 63/65
  2. 56/65
  3. 16/65
  4. 33/65
Solutionसमाधान
Given cos A = 3/5, so sin A = 4/5. Given cos B = 5/13, so sin B = 12/13. Using cos(A - B) = cos A cos B + sin A sin B = (3/5)(5/13) + (4/5)(12/13) = 15/65 + 48/65 = 63/65.
दिया गया cos A = 3/5, अतः sin A = 4/5। दिया गया cos B = 5/13, अतः sin B = 12/13। cos(A - B) = cos A cos B + sin A sin B = (3/5)(5/13) + (4/5)(12/13) = 15/65 + 48/65 = 63/65 का उपयोग करते हुए।

समाधान का रास्ता: cosA=35\cos A = \frac{3}{5}sinA=45\sin A = \frac{4}{5} (3-4-5 triangle)। cosB=513\cos B = \frac{5}{13}sinB=1213\sin B = \frac{12}{13} (5-12-13 triangle)। cos(AB)=35513+451213=1565+4865=6365\cos(A-B) = \frac{3}{5} \cdot \frac{5}{13} + \frac{4}{5} \cdot \frac{12}{13} = \frac{15}{65} + \frac{48}{65} = \frac{63}{65}


क्यों यह प्रश्न: tan(α+β)=1\tan(\alpha+\beta) = 1 recognition — जब numerator = denominator तो answer तुरंत दिखता है।

Previous Year Questionपिछले वर्ष का प्रश्न
If tan α = 1/2 and tan β = 1/3, then tan(α + β) equals:
यदि tan α = 1/2 और tan β = 1/3 हैं, तो tan(α + β) का मान है:
  1. 1
  2. 5/6
  3. 6/5
  4. 2/3
  1. 1
  2. 5/6
  3. 6/5
  4. 2/3
Solutionसमाधान
Using the formula tan(α + β) = (tan α + tan β)/(1 - tan α tan β). Substituting values: tan(α + β) = (1/2 + 1/3)/(1 - 1/2 × 1/3) = (3/6 + 2/6)/(1 - 1/6) = (5/6)/(5/6) = 1.
सूत्र tan(α + β) = (tan α + tan β)/(1 - tan α tan β) का उपयोग करते हुए। मान रखने पर: tan(α + β) = (1/2 + 1/3)/(1 - 1/2 × 1/3) = (3/6 + 2/6)/(1 - 1/6) = (5/6)/(5/6) = 1।

समाधान का रास्ता: 12+1311213=5656=1\frac{\frac{1}{2} + \frac{1}{3}}{1 - \frac{1}{2}\cdot\frac{1}{3}} = \frac{\frac{5}{6}}{\frac{5}{6}} = 1। Numerator और denominator दोनों 56\frac{5}{6} हैं — यह pattern पहचानो।


क्यों यह प्रश्न: Triangle identity — A+B+C=180°A + B + C = 180° वाला standard result। Proof समझ लो, फिर result याद रखो।

Previous Year Questionपिछले वर्ष का प्रश्न
If A + B + C = 180°, then tan A/2 tan B/2 + tan B/2 tan C/2 + tan C/2 tan A/2 equals:
यदि A + B + C = 180° है, तो tan A/2 · tan B/2 + tan B/2 · tan C/2 + tan C/2 · tan A/2 का मान है:
  1. 0
  2. 1
  3. -1
  4. 2
  1. 0
  2. 1
  3. -1
  4. 2
Solutionसमाधान
When A + B + C = 180°, we have (A + B + C)/2 = 90°, so C/2 = 90° - (A + B)/2. Therefore, tan C/2 = cot (A + B)/2 = 1/tan (A + B)/2. Using the identity for the sum of three angles in a triangle, the expression equals 1.
जब A + B + C = 180° हो, तो (A + B + C)/2 = 90°, अतः C/2 = 90° - (A + B)/2। इसलिए tan C/2 = cot (A + B)/2 = 1/tan (A + B)/2। त्रिभुज में तीन कोणों के योग की पहचान का उपयोग करते हुए, व्यंजक का मान 1 होता है।

समाधान का रास्ता: A+B+C2=90°\frac{A+B+C}{2} = 90° इसलिए tanC2=cotA+B2\tan\frac{C}{2} = \cot\frac{A+B}{2}। इसे expand करने पर tanA2tanB2+tanB2tanC2+tanC2tanA2=1\tan\frac{A}{2}\tan\frac{B}{2} + \tan\frac{B}{2}\tan\frac{C}{2} + \tan\frac{C}{2}\tan\frac{A}{2} = 1 सिद्ध होता है। Answer: 1।


क्यों यह प्रश्न: sin18°\sin 18° एक standard result है। Derivation एक बार ज़रूर करो — exam में answer याद रहेगा।

Previous Year Questionपिछले वर्ष का प्रश्न
The value of sin 18° is:
sin 18° का मान है:
  1. (√5 - 1)/4
  2. (√5 + 1)/4
  3. (√3 - 1)/4
  4. (√3 + 1)/4
  1. (√5 - 1)/4
  2. (√5 + 1)/4
  3. (√3 - 1)/4
  4. (√3 + 1)/4
Solutionसमाधान
To find sin 18°, we use the fact that 5 × 18° = 90°. Using the quintuple angle formula and solving the resulting equation, we get sin 18° = (√5 - 1)/4. This is a well-known result in trigonometry.
sin 18° ज्ञात करने के लिए, हम इस तथ्य का उपयोग करते हैं कि 5 × 18° = 90°। पंचगुण कोण सूत्र का उपयोग करके और परिणामी समीकरण को हल करके, हमें sin 18° = (√5 - 1)/4 मिलता है। यह त्रिकोणमिति में एक प्रसिद्ध परिणाम है।

समाधान का रास्ता: 5θ=90°5\theta = 90°, θ=18°\theta = 18° मानो। sin2θ=cos3θ\sin 2\theta = \cos 3\theta लिखो। Expand करो: 4sin2θ+2sinθ1=04\sin^2\theta + 2\sin\theta - 1 = 0। Quadratic solve करो: sin18°=514\sin 18° = \frac{\sqrt{5}-1}{4}


क्यों यह प्रश्न: (1+tanθ)/(1tanθ)=tan(45°+θ)(1+\tan\theta)/(1-\tan\theta) = \tan(45°+\theta) — यह pattern एक बार देख लो, हमेशा के लिए याद रहेगा।

Previous Year Questionपिछले वर्ष का प्रश्न
The value of (1 + tan 15°)/(1 - tan 15°) is:
(1 + tan 15°)/(1 - tan 15°) का मान है:
  1. √3
  2. 1/√3
  3. 2 + √3
  4. 2 - √3
  1. √3
  2. 1/√3
  3. 2 + √3
  4. 2 - √3
Solutionसमाधान
Using the identity (1 + tan θ)/(1 - tan θ) = tan(45° + θ). Therefore, (1 + tan 15°)/(1 - tan 15°) = tan(45° + 15°) = tan 60° = √3.
पहचान (1 + tan θ)/(1 - tan θ) = tan(45° + θ) का उपयोग करते हुए। इसलिए (1 + tan 15°)/(1 - tan 15°) = tan(45° + 15°) = tan 60° = √3।

समाधान का रास्ता: 1+tan15°1tan15°=tan(45°+15°)=tan60°=3\frac{1+\tan 15°}{1-\tan 15°} = \tan(45°+15°) = \tan 60° = \sqrt{3}tan15°\tan 15° की value निकालने की ज़रूरत नहीं।


आम गलतियाँ


संबंधित विषय

SarkariRise पर अभ्यास

Sign up + get 3 free mocks →